Seudónimo Seudónimo

02-02-2021
Mathematics

contestada

NOTE:the answer is a mixed number not a whole number.

NOTEthe answer is a mixed number not a whole number class=

Respuesta :

mariahLashay mariahLashay

02-02-2021

the answer is 4 1/4 its a mixed number

Answer Link

yeet208708xbox yeet208708xbox

02-02-2021

Answer:

The answer is 4 1/4

as a fraction it is 17/4

Answer Link

Otras preguntas

Read these passages: Hec. O, well done! I commend your pains; And every one shall share i' the gains. And now about the cauldron sing, Like elves and fairies i

Lewis structure for CO2

What were Japanese Americans forced to do before being sent to an internment camp? A. buy war bonds B. go to court and fight for their rights C. sell their pope

protests against the Vietnam War began during which president's term of office? Richard Nixon lyndon johnson J.F.K. Dwight eisenhower

PLS HELP!! Solve for x. (763)(50)/295 = (760)(x)/273

what is the link between elevation and climate

cos(x/3)cos(x/3)=1/2(1+cos(2x/3))

think about the different things that 5- 2 could mean. using these meanings, what should - 2 -2 mean if u know the answer can u explain how you got it

What nations claimed to protect Christian interests in the Ottoman Empire? Germany and Spain the United States and France France and Russia Britain and Russia

In A Midsummer Night's Dream: Theseus gives Hermia three options: be put to death, marry the man he has chosen for her, or _______________? become a slave go li