chandnandita989 chandnandita989

03-06-2022
Mathematics

contestada

Find the value of x and y from the following figure.

Find the value of x and y from the following figure class=

Respuesta :

batanounyy batanounyy

03-06-2022

Answer:

X=70

Step-by-step explanation:

aw we can for a triangle, where the 2 angles are complementary from the outer ones, so the 2 angles are 50, and 60

so the third one will be 70

Answer Link

Otras preguntas

What are some conservation issues. This is for Science Please help me i need this for my Collaboration

What percentage of weight change in 6 months is considered abnormal?

nonpermissable replacement for a 4/9a?

BRAINLIESTTT ASAP!! Which regions on this map were once Mexican possessions? Midwest and Southwest Northwest and southern West Coast Southwest and Northeast

Each week you drive 150 miles your car gets 25 miles a gallon and gas prices are three dollars per gallon how much gas will you spend on gas each week

Find the sum 5/17 +4/17

is the answer a, b, c, or d.

PLEASE SOMEONE ANSWER THIS FOR ME Identify the volume and surface area of a sphere with great circle area 144π ft2 in terms of π.

why is a memoir an appropriate text structure for rosa parks to use to share her personal experience of a historical event

Find the exact value of sin(11pi/12)cos(pi/6)-cos(11pi/12)sin(pi/6)