raaeraae22
raaeraae22 raaeraae22
  • 04-02-2017
  • Chemistry
contestada

When is di- used in the name of a hydrocarbon?

Respuesta :

DoctorCass
DoctorCass DoctorCass
  • 04-02-2017
Di- is used when you are naming organic compounds. If you have the same substituent repeated twice in the compund
For example: CH3-CH(CH3)-CH2-CH(CH3)-CH3
This will be named 2,4-dimethylpentane
Answer Link

Otras preguntas

What mass of natural gas (ch4) must you burn to emit 272 kj of heat?
Choose any two countries that experienced the process of decolonization after ww2
The main function of glucose is to supply _______________ for the body.
"the neurohypophysis or posterior lobe of the pituitary gland is not a true endocrine gland because ________."
what role did wine play at the symposium?
Find the sum of the polynomials below. (8x9 + 6x6 - 2x + 6) + (9x9 + 4x6 + 9x + 7) A. 17x9 + 10x6 + 7x + 13 B. 10x9 + 17x6 + 7x + 13 C. 72x9 + 24x6 - 1
The separation of powers within the federal government ensures that
which statement describes the translation of y=-1/2(x-2)^2-2 from standard position?
In 1853, the american navy, led by matthew perry, sailed into _______.
Ervin sells vintage cars. Every three months, he manages to sell 13 cars. Assuming he sells cars at a constant rate, what is the slope of the line that represen